C21H28N2O2 — CID 109132824
2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-ethyl-1-N-phenylcyclopropane-1,2-dicarboxamide (PubChem CID 109132824) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-ethyl-1-N-phenylcyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-ethyl-1-N-phenylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132824 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-ethyl-1-N-phenylcyclopropane-1,2-dicarboxamide |
| SMILES | CCN(C(=O)C1CC1C(=O)NCCC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-2-23(17-11-7-4-8-12-17)21(25)19-15-18(19)20(24)22-14-13-16-9-5-3-6-10-16/h4,7-9,11-12,18-19H,2-3,5-6,10,13-15H2,1H3,(H,22,24) |
| InChIKey | JGDOHCMSZSSDAF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|