C19H28N2O — CID 109014714
N-[2-(cyclohexen-1-yl)ethyl]-3-(N-ethylanilino)propanamide (PubChem CID 109014714) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-(N-ethylanilino)propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(N-ethylanilino)propanamide |
|---|---|
| PubChem CID | 109014714 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-(N-ethylanilino)propanamide |
| SMILES | CCN(CCC(=O)NCCC1=CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H28N2O/c1-2-21(18-11-7-4-8-12-18)16-14-19(22)20-15-13-17-9-5-3-6-10-17/h4,7-9,11-12H,2-3,5-6,10,13-16H2,1H3,(H,20,22) |
| InChIKey | XIRFDASQOBSVJB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|