C19H34N2O2 — CID 3289082
N'-[2-(cyclohexen-1-yl)ethyl]-N-heptylbutanediamide (PubChem CID 3289082) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is N'-[2-(cyclohexen-1-yl)ethyl]-N-heptylbutanediamide.
| Compound Name | N'-[2-(cyclohexen-1-yl)ethyl]-N-heptylbutanediamide |
|---|---|
| PubChem CID | 3289082 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | N'-[2-(cyclohexen-1-yl)ethyl]-N-heptylbutanediamide |
| SMILES | CCCCCCCNC(=O)CCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H34N2O2/c1-2-3-4-5-9-15-20-18(22)12-13-19(23)21-16-14-17-10-7-6-8-11-17/h10H,2-9,11-16H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | JPOSGMQRTSALEG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|