C15H28N2O2 — CID 122160040
1-[2-(cyclohexen-1-yl)ethyl]-3-(5-methoxypentyl)urea (PubChem CID 122160040) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(5-methoxypentyl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(5-methoxypentyl)urea |
|---|---|
| PubChem CID | 122160040 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(5-methoxypentyl)urea |
| SMILES | COCCCCCNC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-19-13-7-3-6-11-16-15(18)17-12-10-14-8-4-2-5-9-14/h8H,2-7,9-13H2,1H3,(H2,16,17,18) |
| InChIKey | VBDJIFPFAXNYNY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|