C12H21NO3 — CID 103842228
N-[2-(cyclopenten-1-yl)ethyl]-2-(2-methoxyethoxy)acetamide (PubChem CID 103842228) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 103842228 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)NCCC1=CCCC1 |
| InChI | InChI=1S/C12H21NO3/c1-15-8-9-16-10-12(14)13-7-6-11-4-2-3-5-11/h4H,2-3,5-10H2,1H3,(H,13,14) |
| InChIKey | LYUVNUWUWPOSJV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|