C13H22N2O3 — CID 2289204
N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-methoxyethyl)oxamide (PubChem CID 2289204) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-methoxyethyl)oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 2289204 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C13H22N2O3/c1-18-10-9-15-13(17)12(16)14-8-7-11-5-3-2-4-6-11/h5H,2-4,6-10H2,1H3,(H,14,16)(H,15,17) |
| InChIKey | QVEZNVPUMOWCBL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|