C20H23F3N2O2 — CID 109132859
2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109132859) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132859 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CC1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3N2O2/c21-20(22,23)14-7-4-8-15(11-14)25-19(27)17-12-16(17)18(26)24-10-9-13-5-2-1-3-6-13/h4-5,7-8,11,16-17H,1-3,6,9-10,12H2,(H,24,26)(H,25,27) |
| InChIKey | JUDJZMLCZJISSP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|