C18H21F3N2O2 — CID 109132496
2-N-cyclohexyl-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109132496) has the molecular formula C18H21F3N2O2 and a molecular weight of 354.37 g/mol. Its IUPAC name is 2-N-cyclohexyl-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-cyclohexyl-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132496 |
| Molecular Formula | C18H21F3N2O2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-N-cyclohexyl-1-N-[3-(trifluoromethyl)phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CC1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H21F3N2O2/c19-18(20,21)11-5-4-8-13(9-11)23-17(25)15-10-14(15)16(24)22-12-6-2-1-3-7-12/h4-5,8-9,12,14-15H,1-3,6-7,10H2,(H,22,24)(H,23,25) |
| InChIKey | NSIBHOWBDXKZOC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |