C16H18Cl2N2O2 — CID 109132157
2-N-cyclopentyl-1-N-(3,4-dichlorophenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109132157) has the molecular formula C16H18Cl2N2O2 and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-N-cyclopentyl-1-N-(3,4-dichlorophenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-cyclopentyl-1-N-(3,4-dichlorophenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132157 |
| Molecular Formula | C16H18Cl2N2O2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-N-cyclopentyl-1-N-(3,4-dichlorophenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1CC1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H18Cl2N2O2/c17-13-6-5-10(7-14(13)18)20-16(22)12-8-11(12)15(21)19-9-3-1-2-4-9/h5-7,9,11-12H,1-4,8H2,(H,19,21)(H,20,22) |
| InChIKey | CAQPQHPMFDDNEV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |