C16H19ClN2O2 — CID 109132096
1-N-(4-chlorophenyl)-2-N-cyclopentylcyclopropane-1,2-dicarboxamide (PubChem CID 109132096) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-N-(4-chlorophenyl)-2-N-cyclopentylcyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(4-chlorophenyl)-2-N-cyclopentylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132096 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-N-(4-chlorophenyl)-2-N-cyclopentylcyclopropane-1,2-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CC1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H19ClN2O2/c17-10-5-7-12(8-6-10)19-16(21)14-9-13(14)15(20)18-11-3-1-2-4-11/h5-8,11,13-14H,1-4,9H2,(H,18,20)(H,19,21) |
| InChIKey | JYANSEATQQQHTM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |