C17H28N2O2 — CID 109132055
2-N-cycloheptyl-1-N-cyclopentylcyclopropane-1,2-dicarboxamide (PubChem CID 109132055) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-N-cycloheptyl-1-N-cyclopentylcyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-cycloheptyl-1-N-cyclopentylcyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109132055 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 2-N-cycloheptyl-1-N-cyclopentylcyclopropane-1,2-dicarboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CC1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H28N2O2/c20-16(18-12-7-3-1-2-4-8-12)14-11-15(14)17(21)19-13-9-5-6-10-13/h12-15H,1-11H2,(H,18,20)(H,19,21) |
| InChIKey | CYPVKOOBXCTISW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |