C13H21NO3 — CID 102105181
ethyl 2-(cyclohexylcarbamoyl)cyclopropane-1-carboxylate (PubChem CID 102105181) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is ethyl 2-(cyclohexylcarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(cyclohexylcarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102105181 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethyl 2-(cyclohexylcarbamoyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c1-2-17-13(16)11-8-10(11)12(15)14-9-6-4-3-5-7-9/h9-11H,2-8H2,1H3,(H,14,15) |
| InChIKey | BJXDBCCFKYJUEQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |