C18H24Cl3NO3 — CID 40538947
2,3,3-trichloroprop-2-enyl (1S,6S)-6-(cycloheptylcarbamoyl)cyclohex-3-ene-1-carboxylate (PubChem CID 40538947) has the molecular formula C18H24Cl3NO3 and a molecular weight of 408.75 g/mol. Its IUPAC name is 2,3,3-trichloroprop-2-enyl (1S,6S)-6-(cycloheptylcarbamoyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | 2,3,3-trichloroprop-2-enyl (1S,6S)-6-(cycloheptylcarbamoyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 40538947 |
| Molecular Formula | C18H24Cl3NO3 |
| Molecular Weight | 408.75 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2,3,3-trichloroprop-2-enyl (1S,6S)-6-(cycloheptylcarbamoyl)cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(NC1CCCCCC1)[C@H]1CC=CC[C@@H]1C(=O)OCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C18H24Cl3NO3/c19-15(16(20)21)11-25-18(24)14-10-6-5-9-13(14)17(23)22-12-7-3-1-2-4-8-12/h5-6,12-14H,1-4,7-11H2,(H,22,23)/t13-,14-/m0/s1 |
| InChIKey | RFDMXJHAVMKBKT-KBPBESRZSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|