C11H11Cl3O4 — CID 747380
(1S,6R)-6-(2,3,3-trichloroprop-2-enoxycarbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 747380) has the molecular formula C11H11Cl3O4 and a molecular weight of 313.56 g/mol. Its IUPAC name is (1S,6R)-6-(2,3,3-trichloroprop-2-enoxycarbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-(2,3,3-trichloroprop-2-enoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 747380 |
| Molecular Formula | C11H11Cl3O4 |
| Molecular Weight | 313.56 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | (1S,6R)-6-(2,3,3-trichloroprop-2-enoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)OCC(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3O4/c12-8(9(13)14)5-18-11(17)7-4-2-1-3-6(7)10(15)16/h1-2,6-7H,3-5H2,(H,15,16)/t6-,7+/m0/s1 |
| InChIKey | WKHHLRIEEVZRNK-NKWVEPMBSA-N |
| XLogP | 3.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|