C8H12CaO4 — CID 175524215
calcium;cyclohex-4-ene-1,2-dicarboxylic acid;hydride (PubChem CID 175524215) has the molecular formula C8H12CaO4 and a molecular weight of 212.26 g/mol. Its IUPAC name is calcium;cyclohex-4-ene-1,2-dicarboxylic acid;hydride.
| Compound Name | calcium;cyclohex-4-ene-1,2-dicarboxylic acid;hydride |
|---|---|
| PubChem CID | 175524215 |
| Molecular Formula | C8H12CaO4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | calcium;cyclohex-4-ene-1,2-dicarboxylic acid;hydride |
| SMILES | O=C(O)C1CC=CCC1C(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C8H10O4.Ca.2H/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;/h1-2,5-6H,3-4H2,(H,9,10)(H,11,12);;;/q;+2;2*-1 |
| InChIKey | IUOPUWLORBUZTC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|