C9H12O4 — CID 132518437
6-(trideuteriomethoxycarbonyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 132518437) has the molecular formula C9H12O4 and a molecular weight of 187.21 g/mol. Its IUPAC name is 6-(trideuteriomethoxycarbonyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(trideuteriomethoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 132518437 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 6-(trideuteriomethoxycarbonyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | [2H]C([2H])([2H])OC(=O)C1CC=CCC1C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-3,6-7H,4-5H2,1H3,(H,10,11)/i1D3 |
| InChIKey | MYYLMIDEMAPSGH-FIBGUPNXSA-N |
| XLogP | 0.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|