C9H11ClO3 — CID 45081835
methyl (1R,6R)-6-carbonochloridoylcyclohex-3-ene-1-carboxylate (PubChem CID 45081835) has the molecular formula C9H11ClO3 and a molecular weight of 202.64 g/mol. Its IUPAC name is methyl (1R,6R)-6-carbonochloridoylcyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,6R)-6-carbonochloridoylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 45081835 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | methyl (1R,6R)-6-carbonochloridoylcyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=CC[C@H]1C(=O)Cl |
| InChI | InChI=1S/C9H11ClO3/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-3,6-7H,4-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | MWOSGKUVHHKVER-RNFRBKRXSA-N |
| XLogP | 1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|