C9H13BrO2 — CID 10889806
methyl (1S,6R)-6-(bromomethyl)cyclohex-3-ene-1-carboxylate (PubChem CID 10889806) has the molecular formula C9H13BrO2 and a molecular weight of 233.10 g/mol. Its IUPAC name is methyl (1S,6R)-6-(bromomethyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1S,6R)-6-(bromomethyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10889806 |
| Molecular Formula | C9H13BrO2 |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | methyl (1S,6R)-6-(bromomethyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC=CC[C@H]1CBr |
| InChI | InChI=1S/C9H13BrO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-3,7-8H,4-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | OKFIAKMPPRIFBN-YUMQZZPRSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|