C6H9BO2 — CID 89108103
CID 89108103 (PubChem CID 89108103) has the molecular formula C6H9BO2 and a molecular weight of 123.95 g/mol.
| Compound Name | CID 89108103 |
|---|---|
| PubChem CID | 89108103 |
| Molecular Formula | C6H9BO2 |
| Molecular Weight | 123.95 g/mol |
| Exact Mass | 124.07 |
| IUPAC Name | — |
| SMILES | [B]C[C@@H]1C[C@H]1C(=O)OC |
| InChI | InChI=1S/C6H9BO2/c1-9-6(8)5-2-4(5)3-7/h4-5H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | JTEFIARLYIHDJI-CRCLSJGQSA-N |
| XLogP | 0.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.95 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|