2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid

C8H13NO4 — CID 11160410

IUPAC2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid
SMILESCOC(=O)[C@@H]1C[C@H]1CC(N)C(=O)O
InChIInChI=1S/C8H13NO4/c1-13-8(12)5-2-4(5)3-6(9)7(10)11/h4-6H,2-3,9H2,1H3,(H,10,11)/t4-,5+,6?/m0/s1
InChIKeyAUGUVXXCNMLZFK-YRZWDFBDSA-N
MW187.19 g/mol
LogP-0.40
Rot. Bonds4

About 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid

2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid (PubChem CID 11160410) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid.

Molecular Properties

Compound Name2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid
PubChem CID11160410
Molecular FormulaC8H13NO4
Molecular Weight187.19 g/mol
Exact Mass187.08
IUPAC Name2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid
SMILESCOC(=O)[C@@H]1C[C@H]1CC(N)C(=O)O
InChIInChI=1S/C8H13NO4/c1-13-8(12)5-2-4(5)3-6(9)7(10)11/h4-6H,2-3,9H2,1H3,(H,10,11)/t4-,5+,6?/m0/s1
InChIKeyAUGUVXXCNMLZFK-YRZWDFBDSA-N
XLogP-0.40
TPSA89.62 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.19
LogP ≤ 5-0.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid?
The IUPAC name of 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid (CID 11160410) is 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid.
What is the SMILES notation for 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid?
The canonical SMILES for 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid is COC(=O)[C@@H]1C[C@H]1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid?
The InChIKey is AUGUVXXCNMLZFK-YRZWDFBDSA-N. The full InChI is InChI=1S/C8H13NO4/c1-13-8(12)5-2-4(5)3-6(9)7(10)11/h4-6H,2-3,9H2,1H3,(H,10,11)/t4-,5+,6?/m0/s1.
What are the key properties of 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid?
2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid has a molecular weight of 187.19 g/mol, XLogP of -0.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(1S,2R)-2-methoxycarbonylcyclopropyl]propanoic acid is sourced from PubChem (CID 11160410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).