C14H20O8 — CID 102016488
tetramethyl (1S,2R,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylate (PubChem CID 102016488) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is tetramethyl (1S,2R,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylate.
| Compound Name | tetramethyl (1S,2R,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 102016488 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | tetramethyl (1S,2R,4S,5R)-cyclohexane-1,2,4,5-tetracarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)[C@@H](C(=O)OC)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C14H20O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h7-10H,5-6H2,1-4H3/t7-,8+,9+,10- |
| InChIKey | WXORPFRDBYGNKY-FIRGSJFUSA-N |
| XLogP | -0.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|