About cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate
cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate (PubChem CID 14489527) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate.
Analyze cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate?
The IUPAC name of cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate (CID 14489527) is cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate.
What is the SMILES notation for cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate?
The canonical SMILES for cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate is COC(=O)[C@H]1CC(OC)C[C@H]1C(=O)OC.
What is the InChIKey of cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate?
The InChIKey is ACAPWAVIOQGQJF-IEESLHIDSA-N. The full InChI is InChI=1S/C10H16O5/c1-13-6-4-7(9(11)14-2)8(5-6)10(12)15-3/h6-8H,4-5H2,1-3H3/t6?,7-,8+.
What are the key properties of cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate?
cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate has a molecular weight of 216.23 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-dimethyl (1R,2S)-4-methoxycyclopentane-1,2-dicarboxylate is sourced from PubChem (CID 14489527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).