C11H16O4 — CID 174166263
dimethyl (1R,2S,5S)-bicyclo[2.2.1]heptane-2,5-dicarboxylate (PubChem CID 174166263) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is dimethyl (1R,2S,5S)-bicyclo[2.2.1]heptane-2,5-dicarboxylate.
| Compound Name | dimethyl (1R,2S,5S)-bicyclo[2.2.1]heptane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 174166263 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | dimethyl (1R,2S,5S)-bicyclo[2.2.1]heptane-2,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]2CC1C[C@@H]2C(=O)OC |
| InChI | InChI=1S/C11H16O4/c1-14-10(12)8-4-7-3-6(8)5-9(7)11(13)15-2/h6-9H,3-5H2,1-2H3/t6-,7?,8+,9+/m1/s1 |
| InChIKey | UMXNNMWDDAKHJK-FAZFRDGJSA-N |
| XLogP | 0.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |