C15H20O4 — CID 139970844
9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid (PubChem CID 139970844) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid.
| Compound Name | 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid |
|---|---|
| PubChem CID | 139970844 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid |
| SMILES | COC(=O)C1CC2CC1C1C3CC(C(=O)O)C(C3)C21 |
| InChI | InChI=1S/C15H20O4/c1-19-15(18)11-5-7-3-9(11)13-6-2-8(12(7)13)10(4-6)14(16)17/h6-13H,2-5H2,1H3,(H,16,17) |
| InChIKey | BRJLHRITPAKLEA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|