9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid

C15H20O4 — CID 139970844

IUPAC9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid
SMILESCOC(=O)C1CC2CC1C1C3CC(C(=O)O)C(C3)C21
InChIInChI=1S/C15H20O4/c1-19-15(18)11-5-7-3-9(11)13-6-2-8(12(7)13)10(4-6)14(16)17/h6-13H,2-5H2,1H3,(H,16,17)
InChIKeyBRJLHRITPAKLEA-UHFFFAOYSA-N
MW264.32 g/mol
LogP1.79
Rot. Bonds2

About 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid

9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid (PubChem CID 139970844) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid.

Molecular Properties

Compound Name9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid
PubChem CID139970844
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid
SMILESCOC(=O)C1CC2CC1C1C3CC(C(=O)O)C(C3)C21
InChIInChI=1S/C15H20O4/c1-19-15(18)11-5-7-3-9(11)13-6-2-8(12(7)13)10(4-6)14(16)17/h6-13H,2-5H2,1H3,(H,16,17)
InChIKeyBRJLHRITPAKLEA-UHFFFAOYSA-N
XLogP1.79
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 51.79
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}

Analyze 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid?
The IUPAC name of 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid (CID 139970844) is 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid.
What is the SMILES notation for 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid?
The canonical SMILES for 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid is COC(=O)C1CC2CC1C1C3CC(C(=O)O)C(C3)C21.
What is the InChIKey of 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid?
The InChIKey is BRJLHRITPAKLEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-19-15(18)11-5-7-3-9(11)13-6-2-8(12(7)13)10(4-6)14(16)17/h6-13H,2-5H2,1H3,(H,16,17).
What are the key properties of 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid?
9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid has a molecular weight of 264.32 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methoxycarbonyltetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylic acid is sourced from PubChem (CID 139970844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).