C10H14O4 — CID 564809
2-methoxycarbonylbicyclo[2.2.1]heptane-7-carboxylic acid (PubChem CID 564809) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-methoxycarbonylbicyclo[2.2.1]heptane-7-carboxylic acid.
| Compound Name | 2-methoxycarbonylbicyclo[2.2.1]heptane-7-carboxylic acid |
|---|---|
| PubChem CID | 564809 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-methoxycarbonylbicyclo[2.2.1]heptane-7-carboxylic acid |
| SMILES | COC(=O)C1CC2CCC1C2C(=O)O |
| InChI | InChI=1S/C10H14O4/c1-14-10(13)7-4-5-2-3-6(7)8(5)9(11)12/h5-8H,2-4H2,1H3,(H,11,12) |
| InChIKey | RXCUMUCASMKTDM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |