C14H18O8 — CID 20810647
3,5,6-tris(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 20810647) has the molecular formula C14H18O8 and a molecular weight of 314.29 g/mol. Its IUPAC name is 3,5,6-tris(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 3,5,6-tris(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 20810647 |
| Molecular Formula | C14H18O8 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3,5,6-tris(methoxycarbonyl)bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | COC(=O)C1C2CC(C1C(=O)O)C(C(=O)OC)C2C(=O)OC |
| InChI | InChI=1S/C14H18O8/c1-20-12(17)8-6-4-5(7(8)11(15)16)9(13(18)21-2)10(6)14(19)22-3/h5-10H,4H2,1-3H3,(H,15,16) |
| InChIKey | CBVBDZCKFFSTPK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|