C15H18O4 — CID 71127857
dimethyl (10R,11S)-pentacyclo[5.4.0.02,4.03,9.06,8]undecane-10,11-dicarboxylate (PubChem CID 71127857) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is dimethyl (10R,11S)-pentacyclo[5.4.0.02,4.03,9.06,8]undecane-10,11-dicarboxylate.
| Compound Name | dimethyl (10R,11S)-pentacyclo[5.4.0.02,4.03,9.06,8]undecane-10,11-dicarboxylate |
|---|---|
| PubChem CID | 71127857 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | dimethyl (10R,11S)-pentacyclo[5.4.0.02,4.03,9.06,8]undecane-10,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2C3C4CC5C2C5C(C43)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C15H18O4/c1-18-14(16)12-10-6-4-3-5-7(10)9(5)11(8(4)6)13(12)15(17)19-2/h4-13H,3H2,1-2H3/t4?,5?,6?,7?,8?,9?,10?,11?,12-,13+ |
| InChIKey | CAMOKDNYJFGPSH-DPSFDBTBSA-N |
| XLogP | 0.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |