C18H24O4 — CID 163320232
dimethyl (1R,6R,8S)-pentacyclo[6.4.1.13,6.02,7.09,12]tetradecane-10,11-dicarboxylate (PubChem CID 163320232) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is dimethyl (1R,6R,8S)-pentacyclo[6.4.1.13,6.02,7.09,12]tetradecane-10,11-dicarboxylate.
| Compound Name | dimethyl (1R,6R,8S)-pentacyclo[6.4.1.13,6.02,7.09,12]tetradecane-10,11-dicarboxylate |
|---|---|
| PubChem CID | 163320232 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | dimethyl (1R,6R,8S)-pentacyclo[6.4.1.13,6.02,7.09,12]tetradecane-10,11-dicarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)C2C1[C@@H]1C[C@H]2C2C1C1CC[C@@H]2C1 |
| InChI | InChI=1S/C18H24O4/c1-21-17(19)15-13-9-6-10(14(13)16(15)18(20)22-2)12-8-4-3-7(5-8)11(9)12/h7-16H,3-6H2,1-2H3/t7-,8?,9+,10-,11?,12?,13?,14?,15?,16?/m1/s1 |
| InChIKey | DRLYBASHSXUIKP-MVDQKIBJSA-N |
| XLogP | 2.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|