C10H15NO3 — CID 14331163
methyl 3-carbamoylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 14331163) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl 3-carbamoylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl 3-carbamoylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 14331163 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl 3-carbamoylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(C2)C1C(N)=O |
| InChI | InChI=1S/C10H15NO3/c1-14-10(13)8-6-3-2-5(4-6)7(8)9(11)12/h5-8H,2-4H2,1H3,(H2,11,12) |
| InChIKey | SRIJUNQKGGMCTG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |