C9H14N2O2 — CID 98112397
(1S,2S,3R,4S)-bicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 98112397) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1S,2S,3R,4S)-bicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | (1S,2S,3R,4S)-bicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 98112397 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (1S,2S,3R,4S)-bicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1C(N)=O |
| InChI | InChI=1S/C9H14N2O2/c10-8(12)6-4-1-2-5(3-4)7(6)9(11)13/h4-7H,1-3H2,(H2,10,12)(H2,11,13)/t4-,5-,6-,7+/m0/s1 |
| InChIKey | CRISHQZINOBKII-ZTYPAOSTSA-N |
| XLogP | -0.38 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |