C10H16N2O3 — CID 41097782
amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate (PubChem CID 41097782) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 41097782 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate |
| SMILES | NOC(=O)[C@@H]1C2CCC(CC2)[C@H]1C(N)=O |
| InChI | InChI=1S/C10H16N2O3/c11-9(13)7-5-1-3-6(4-2-5)8(7)10(14)15-12/h5-8H,1-4,12H2,(H2,11,13)/t5?,6?,7-,8-/m1/s1 |
| InChIKey | KPWQPUDDKXATES-DWYQZRHDSA-N |
| XLogP | -0.06 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|