amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate

C10H16N2O3 — CID 41097782

IUPACamino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate
SMILESNOC(=O)[C@@H]1C2CCC(CC2)[C@H]1C(N)=O
InChIInChI=1S/C10H16N2O3/c11-9(13)7-5-1-3-6(4-2-5)8(7)10(14)15-12/h5-8H,1-4,12H2,(H2,11,13)/t5?,6?,7-,8-/m1/s1
InChIKeyKPWQPUDDKXATES-DWYQZRHDSA-N
MW212.25 g/mol
LogP-0.06
Rot. Bonds2

About amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate

amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate (PubChem CID 41097782) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate.

Molecular Properties

Compound Nameamino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate
PubChem CID41097782
Molecular FormulaC10H16N2O3
Molecular Weight212.25 g/mol
Exact Mass212.12
IUPAC Nameamino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate
SMILESNOC(=O)[C@@H]1C2CCC(CC2)[C@H]1C(N)=O
InChIInChI=1S/C10H16N2O3/c11-9(13)7-5-1-3-6(4-2-5)8(7)10(14)15-12/h5-8H,1-4,12H2,(H2,11,13)/t5?,6?,7-,8-/m1/s1
InChIKeyKPWQPUDDKXATES-DWYQZRHDSA-N
XLogP-0.06
TPSA95.41 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 5-0.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate?
The IUPAC name of amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate (CID 41097782) is amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate.
What is the SMILES notation for amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate?
The canonical SMILES for amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate is NOC(=O)[C@@H]1C2CCC(CC2)[C@H]1C(N)=O.
What is the InChIKey of amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate?
The InChIKey is KPWQPUDDKXATES-DWYQZRHDSA-N. The full InChI is InChI=1S/C10H16N2O3/c11-9(13)7-5-1-3-6(4-2-5)8(7)10(14)15-12/h5-8H,1-4,12H2,(H2,11,13)/t5?,6?,7-,8-/m1/s1.
What are the key properties of amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate?
amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate has a molecular weight of 212.25 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino (2R,3R)-3-carbamoylbicyclo[2.2.2]octane-2-carboxylate is sourced from PubChem (CID 41097782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).