C10H17NO2 — CID 67974121
methyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate (PubChem CID 67974121) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 67974121 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | methyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C2CCC(CC2)[C@@H]1N |
| InChI | InChI=1S/C10H17NO2/c1-13-10(12)8-6-2-4-7(5-3-6)9(8)11/h6-9H,2-5,11H2,1H3/t6?,7?,8-,9-/m0/s1 |
| InChIKey | KNPLGHZLVZHFSD-PEBLOWIWSA-N |
| XLogP | 0.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |