C11H15NO3 — CID 71290325
amino 3-acetylbicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 71290325) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is amino 3-acetylbicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | amino 3-acetylbicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 71290325 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | amino 3-acetylbicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CC(=O)C1C2C=CC(CC2)C1C(=O)ON |
| InChI | InChI=1S/C11H15NO3/c1-6(13)9-7-2-4-8(5-3-7)10(9)11(14)15-12/h2,4,7-10H,3,5,12H2,1H3 |
| InChIKey | WLVKYRBQYRGQJU-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|