C24H36O4 — CID 171777455
bis(5-methylhex-5-enyl) bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 171777455) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is bis(5-methylhex-5-enyl) bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | bis(5-methylhex-5-enyl) bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 171777455 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | bis(5-methylhex-5-enyl) bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | C=C(C)CCCCOC(=O)C1C2C=CC(CC2)C1C(=O)OCCCCC(=C)C |
| InChI | InChI=1S/C24H36O4/c1-17(2)9-5-7-15-27-23(25)21-19-11-13-20(14-12-19)22(21)24(26)28-16-8-6-10-18(3)4/h11,13,19-22H,1,3,5-10,12,14-16H2,2,4H3 |
| InChIKey | VUTPGIBDWYBFAN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|