C25H38O4 — CID 171777457
bis(5-methylideneheptyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 171777457) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is bis(5-methylideneheptyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(5-methylideneheptyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 171777457 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | bis(5-methylideneheptyl) bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | C=C(CC)CCCCOC(=O)C1C2C=CC(C2)C1C(=O)OCCCCC(=C)CC |
| InChI | InChI=1S/C25H38O4/c1-5-18(3)11-7-9-15-28-24(26)22-20-13-14-21(17-20)23(22)25(27)29-16-10-8-12-19(4)6-2/h13-14,20-23H,3-12,15-17H2,1-2H3 |
| InChIKey | BIGCEVQEMHHYOK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|