C15H18O4 — CID 98168327
bis(prop-2-enyl) (1R,2S,3S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 98168327) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is bis(prop-2-enyl) (1R,2S,3S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) (1R,2S,3S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 98168327 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | bis(prop-2-enyl) (1R,2S,3S,4R)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@@H](C(=O)OCC=C)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H18O4/c1-3-7-18-14(16)12-10-5-6-11(9-10)13(12)15(17)19-8-4-2/h3-6,10-13H,1-2,7-9H2/t10-,11-,12-,13-/m0/s1 |
| InChIKey | GSJILIBJNYDORI-CYDGBPFRSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|