C21H30O8 — CID 22023846
bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 22023846) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22023846 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)COC(=O)C1C2C=CC(C2)C1C(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30O8/c1-20(2,3)28-14(22)10-26-18(24)16-12-7-8-13(9-12)17(16)19(25)27-11-15(23)29-21(4,5)6/h7-8,12-13,16-17H,9-11H2,1-6H3 |
| InChIKey | VMQPAOIFXSIHEJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|