C19H24O2 — CID 139805804
tert-butyl 3-benzylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 139805804) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is tert-butyl 3-benzylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl 3-benzylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 139805804 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | tert-butyl 3-benzylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2C=CC(C2)C1Cc1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-19(2,3)21-18(20)17-15-10-9-14(12-15)16(17)11-13-7-5-4-6-8-13/h4-10,14-17H,11-12H2,1-3H3 |
| InChIKey | PPXKEIMTRSHITB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|