C25H29NO5S — CID 68816967
tert-butyl 3-[(4-phenylmethoxyphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 68816967) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is tert-butyl 3-[(4-phenylmethoxyphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl 3-[(4-phenylmethoxyphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 68816967 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | tert-butyl 3-[(4-phenylmethoxyphenyl)sulfonylamino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2C=CC(C2)C1NS(=O)(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29NO5S/c1-25(2,3)31-24(27)22-18-9-10-19(15-18)23(22)26-32(28,29)21-13-11-20(12-14-21)30-16-17-7-5-4-6-8-17/h4-14,18-19,22-23,26H,15-16H2,1-3H3 |
| InChIKey | JEOLQFUSTIXEPH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|