C16H15O4- — CID 18389504
(1R,2R,3R,4R)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18389504) has the molecular formula C16H15O4- and a molecular weight of 271.29 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3R,4R)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18389504 |
| Molecular Formula | C16H15O4- |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (1R,2R,3R,4R)-3-phenylmethoxycarbonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@H](C(=O)OCc2ccccc2)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H16O4/c17-15(18)13-11-6-7-12(8-11)14(13)16(19)20-9-10-4-2-1-3-5-10/h1-7,11-14H,8-9H2,(H,17,18)/p-1/t11-,12-,13+,14+/m0/s1 |
| InChIKey | ZYHNWUUZQVZDNM-IGQOVBAYSA-M |
| XLogP | 0.92 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|