C24H26O4 — CID 90715861
dibenzyl bicyclo[2.2.2]octane-2,3-dicarboxylate (PubChem CID 90715861) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is dibenzyl bicyclo[2.2.2]octane-2,3-dicarboxylate.
| Compound Name | dibenzyl bicyclo[2.2.2]octane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 90715861 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | dibenzyl bicyclo[2.2.2]octane-2,3-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)C1C2CCC(CC2)C1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H26O4/c25-23(27-15-17-7-3-1-4-8-17)21-19-11-13-20(14-12-19)22(21)24(26)28-16-18-9-5-2-6-10-18/h1-10,19-22H,11-16H2 |
| InChIKey | LCXOAUDCZATCGO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |