C25H28O4 — CID 59449188
dibenzyl (2S,3R)-5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 59449188) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is dibenzyl (2S,3R)-5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dibenzyl (2S,3R)-5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 59449188 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | dibenzyl (2S,3R)-5,6-dimethylbicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CC1C(C)C2CC1[C@@H](C(=O)OCc1ccccc1)[C@H]2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H28O4/c1-16-17(2)21-13-20(16)22(24(26)28-14-18-9-5-3-6-10-18)23(21)25(27)29-15-19-11-7-4-8-12-19/h3-12,16-17,20-23H,13-15H2,1-2H3/t16?,17?,20?,21?,22-,23+ |
| InChIKey | CDWGBDIOVHQMPN-FQDSVZQJSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |