C16H20O2 — CID 154453040
benzyl bicyclo[3.2.1]octane-8-carboxylate (PubChem CID 154453040) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is benzyl bicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl bicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 154453040 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | benzyl bicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C2CCCC1CC2 |
| InChI | InChI=1S/C16H20O2/c17-16(18-11-12-5-2-1-3-6-12)15-13-7-4-8-14(15)10-9-13/h1-3,5-6,13-15H,4,7-11H2 |
| InChIKey | OYIWGVQANIBFPW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |