C24H22N2O4 — CID 18664013
dibenzyl (1S,2S,3S,4S)-3,4-bis(cyanomethyl)cyclobutane-1,2-dicarboxylate (PubChem CID 18664013) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is dibenzyl (1S,2S,3S,4S)-3,4-bis(cyanomethyl)cyclobutane-1,2-dicarboxylate.
| Compound Name | dibenzyl (1S,2S,3S,4S)-3,4-bis(cyanomethyl)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 18664013 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | dibenzyl (1S,2S,3S,4S)-3,4-bis(cyanomethyl)cyclobutane-1,2-dicarboxylate |
| SMILES | N#CC[C@H]1[C@H](CC#N)[C@H](C(=O)OCc2ccccc2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H22N2O4/c25-13-11-19-20(12-14-26)22(24(28)30-16-18-9-5-2-6-10-18)21(19)23(27)29-15-17-7-3-1-4-8-17/h1-10,19-22H,11-12,15-16H2/t19-,20-,21-,22-/m0/s1 |
| InChIKey | TXBSRGVUDWZCAK-CMOCDZPBSA-N |
| XLogP | 3.78 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |