About benzyl 2-cyanoacetate
benzyl 2-cyanoacetate (PubChem CID 560818) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is benzyl 2-cyanoacetate.
Molecular Properties
| Compound Name | benzyl 2-cyanoacetate |
| PubChem CID | 560818 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | benzyl 2-cyanoacetate |
| SMILES | N#CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C10H9NO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6,8H2 |
| InChIKey | RCUIWQWWDLZNMS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-cyanoacetate?
The IUPAC name of benzyl 2-cyanoacetate (CID 560818) is benzyl 2-cyanoacetate.
What is the SMILES notation for benzyl 2-cyanoacetate?
The canonical SMILES for benzyl 2-cyanoacetate is N#CCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-cyanoacetate?
The InChIKey is RCUIWQWWDLZNMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c11-7-6-10(12)13-8-9-4-2-1-3-5-9/h1-5H,6,8H2.
What are the key properties of benzyl 2-cyanoacetate?
benzyl 2-cyanoacetate has a molecular weight of 175.19 g/mol, XLogP of 1.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-cyanoacetate is sourced from PubChem (CID 560818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).