About (2-phenylacetyl) 2-cyanoacetate
(2-phenylacetyl) 2-cyanoacetate (PubChem CID 162512622) has the molecular formula C11H9NO3
and a molecular weight of 203.20 g/mol. Its IUPAC name is (2-phenylacetyl) 2-cyanoacetate.
Molecular Properties
| Compound Name | (2-phenylacetyl) 2-cyanoacetate |
| PubChem CID | 162512622 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (2-phenylacetyl) 2-cyanoacetate |
| SMILES | N#CCC(=O)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H9NO3/c12-7-6-10(13)15-11(14)8-9-4-2-1-3-5-9/h1-5H,6,8H2 |
| InChIKey | LMXJOKALIBGKOE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylacetyl) 2-cyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylacetyl) 2-cyanoacetate?
The IUPAC name of (2-phenylacetyl) 2-cyanoacetate (CID 162512622) is (2-phenylacetyl) 2-cyanoacetate.
What is the SMILES notation for (2-phenylacetyl) 2-cyanoacetate?
The canonical SMILES for (2-phenylacetyl) 2-cyanoacetate is N#CCC(=O)OC(=O)Cc1ccccc1.
What is the InChIKey of (2-phenylacetyl) 2-cyanoacetate?
The InChIKey is LMXJOKALIBGKOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3/c12-7-6-10(13)15-11(14)8-9-4-2-1-3-5-9/h1-5H,6,8H2.
What are the key properties of (2-phenylacetyl) 2-cyanoacetate?
(2-phenylacetyl) 2-cyanoacetate has a molecular weight of 203.20 g/mol, XLogP of 1.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylacetyl) 2-cyanoacetate is sourced from PubChem (CID 162512622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).