About (2-phenylacetyl) butanoate
(2-phenylacetyl) butanoate (PubChem CID 54432060) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is (2-phenylacetyl) butanoate.
Molecular Properties
| Compound Name | (2-phenylacetyl) butanoate |
| PubChem CID | 54432060 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2-phenylacetyl) butanoate |
| SMILES | CCCC(=O)OC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-2-6-11(13)15-12(14)9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3 |
| InChIKey | WIDQZWYBQLCMSG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylacetyl) butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylacetyl) butanoate?
The IUPAC name of (2-phenylacetyl) butanoate (CID 54432060) is (2-phenylacetyl) butanoate.
What is the SMILES notation for (2-phenylacetyl) butanoate?
The canonical SMILES for (2-phenylacetyl) butanoate is CCCC(=O)OC(=O)Cc1ccccc1.
What is the InChIKey of (2-phenylacetyl) butanoate?
The InChIKey is WIDQZWYBQLCMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-2-6-11(13)15-12(14)9-10-7-4-3-5-8-10/h3-5,7-8H,2,6,9H2,1H3.
What are the key properties of (2-phenylacetyl) butanoate?
(2-phenylacetyl) butanoate has a molecular weight of 206.24 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylacetyl) butanoate is sourced from PubChem (CID 54432060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).