About 3-phenylpropanoyl 3-phenylpropanoate
3-phenylpropanoyl 3-phenylpropanoate (PubChem CID 13024780) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-phenylpropanoyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | 3-phenylpropanoyl 3-phenylpropanoate |
| PubChem CID | 13024780 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3-phenylpropanoyl 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H18O3/c19-17(13-11-15-7-3-1-4-8-15)21-18(20)14-12-16-9-5-2-6-10-16/h1-10H,11-14H2 |
| InChIKey | SQAHPYZABTWPNY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropanoyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanoyl 3-phenylpropanoate?
The IUPAC name of 3-phenylpropanoyl 3-phenylpropanoate (CID 13024780) is 3-phenylpropanoyl 3-phenylpropanoate.
What is the SMILES notation for 3-phenylpropanoyl 3-phenylpropanoate?
The canonical SMILES for 3-phenylpropanoyl 3-phenylpropanoate is O=C(CCc1ccccc1)OC(=O)CCc1ccccc1.
What is the InChIKey of 3-phenylpropanoyl 3-phenylpropanoate?
The InChIKey is SQAHPYZABTWPNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c19-17(13-11-15-7-3-1-4-8-15)21-18(20)14-12-16-9-5-2-6-10-16/h1-10H,11-14H2.
What are the key properties of 3-phenylpropanoyl 3-phenylpropanoate?
3-phenylpropanoyl 3-phenylpropanoate has a molecular weight of 282.34 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanoyl 3-phenylpropanoate is sourced from PubChem (CID 13024780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).