About phosphono 3-phenylpropanoate
phosphono 3-phenylpropanoate (PubChem CID 57243225) has the molecular formula C9H11O5P
and a molecular weight of 230.16 g/mol. Its IUPAC name is phosphono 3-phenylpropanoate.
Molecular Properties
| Compound Name | phosphono 3-phenylpropanoate |
| PubChem CID | 57243225 |
| Molecular Formula | C9H11O5P |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | phosphono 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OP(=O)(O)O |
| InChI | InChI=1S/C9H11O5P/c10-9(14-15(11,12)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,12,13) |
| InChIKey | OKQWYQFWAPFBBI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphono 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphono 3-phenylpropanoate?
The IUPAC name of phosphono 3-phenylpropanoate (CID 57243225) is phosphono 3-phenylpropanoate.
What is the SMILES notation for phosphono 3-phenylpropanoate?
The canonical SMILES for phosphono 3-phenylpropanoate is O=C(CCc1ccccc1)OP(=O)(O)O.
What is the InChIKey of phosphono 3-phenylpropanoate?
The InChIKey is OKQWYQFWAPFBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O5P/c10-9(14-15(11,12)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,12,13).
What are the key properties of phosphono 3-phenylpropanoate?
phosphono 3-phenylpropanoate has a molecular weight of 230.16 g/mol, XLogP of 1.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono 3-phenylpropanoate is sourced from PubChem (CID 57243225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).