About 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate
2-(2-methoxyethoxy)ethyl 3-phenylpropanoate (PubChem CID 70881793) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate.
Molecular Properties
| Compound Name | 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate |
| PubChem CID | 70881793 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate |
| SMILES | COCCOCCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H20O4/c1-16-9-10-17-11-12-18-14(15)8-7-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | BVNAXWVSZLWDKC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate?
The IUPAC name of 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate (CID 70881793) is 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate.
What is the SMILES notation for 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate?
The canonical SMILES for 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate is COCCOCCOC(=O)CCc1ccccc1.
What is the InChIKey of 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate?
The InChIKey is BVNAXWVSZLWDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-16-9-10-17-11-12-18-14(15)8-7-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3.
What are the key properties of 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate?
2-(2-methoxyethoxy)ethyl 3-phenylpropanoate has a molecular weight of 252.31 g/mol, XLogP of 1.83, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethoxy)ethyl 3-phenylpropanoate is sourced from PubChem (CID 70881793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).